C15H20Cl3NO3 — CID 7036861
[(1R)-2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl] N-butylcarbamate (PubChem CID 7036861) has the molecular formula C15H20Cl3NO3 and a molecular weight of 368.69 g/mol. Its IUPAC name is [(1R)-2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl] N-butylcarbamate.
| Compound Name | [(1R)-2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl] N-butylcarbamate |
|---|---|
| PubChem CID | 7036861 |
| Molecular Formula | C15H20Cl3NO3 |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [(1R)-2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[C@H](c1ccc(OCC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3NO3/c1-3-5-10-19-14(20)22-13(15(16,17)18)11-6-8-12(9-7-11)21-4-2/h6-9,13H,3-5,10H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | OYNDYVBKHLBUNZ-CYBMUJFWSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|