C23H18F3N3O4S — CID 70368676
5-hydroxy-1-[(11S)-5-oxo-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368676) has the molecular formula C23H18F3N3O4S and a molecular weight of 489.48 g/mol. Its IUPAC name is 5-hydroxy-1-[(11S)-5-oxo-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-hydroxy-1-[(11S)-5-oxo-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368676 |
| Molecular Formula | C23H18F3N3O4S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 5-hydroxy-1-[(11S)-5-oxo-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@H]2c3ccccc3CS(=O)c3ccccc32)CN1CC(F)(F)F |
| InChI | InChI=1S/C23H18F3N3O4S/c24-23(25,26)12-27-13-29(28-10-9-17(30)21(31)20(28)22(27)32)19-15-6-2-1-5-14(15)11-34(33)18-8-4-3-7-16(18)19/h1-10,19,31H,11-13H2/t19-,34?/m0/s1 |
| InChIKey | CYNSMRGHFMLGLV-IZPSYREMSA-N |
| XLogP | 2.88 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |