C14H8Cl2F3N — CID 70369657
benzonitrile;1,4-dichloro-2-(trifluoromethyl)benzene (PubChem CID 70369657) has the molecular formula C14H8Cl2F3N and a molecular weight of 318.13 g/mol. Its IUPAC name is benzonitrile;1,4-dichloro-2-(trifluoromethyl)benzene.
| Compound Name | benzonitrile;1,4-dichloro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 70369657 |
| Molecular Formula | C14H8Cl2F3N |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | benzonitrile;1,4-dichloro-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)ccc1Cl.N#Cc1ccccc1 |
| InChI | InChI=1S/C7H3Cl2F3.C7H5N/c8-4-1-2-6(9)5(3-4)7(10,11)12;8-6-7-4-2-1-3-5-7/h1-3H;1-5H |
| InChIKey | CGULDKZNASUBFS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |