C35H59N3O4 — CID 70370923
(2S,4S,5S)-6-cyclohexyl-5-(3,3-dimethylbutanoylamino)-4-hydroxy-N-[(2S,3S)-3-methyl-2-(2-phenylethylamino)pentanoyl]-2-propan-2-ylhexanamide (PubChem CID 70370923) has the molecular formula C35H59N3O4 and a molecular weight of 585.87 g/mol. Its IUPAC name is (2S,4S,5S)-6-cyclohexyl-5-(3,3-dimethylbutanoylamino)-4-hydroxy-N-[(2S,3S)-3-methyl-2-(2-phenylethylamino)pentanoyl]-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-6-cyclohexyl-5-(3,3-dimethylbutanoylamino)-4-hydroxy-N-[(2S,3S)-3-methyl-2-(2-phenylethylamino)pentanoyl]-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 70370923 |
| Molecular Formula | C35H59N3O4 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.45 |
| IUPAC Name | (2S,4S,5S)-6-cyclohexyl-5-(3,3-dimethylbutanoylamino)-4-hydroxy-N-[(2S,3S)-3-methyl-2-(2-phenylethylamino)pentanoyl]-2-propan-2-ylhexanamide |
| SMILES | CC[C@H](C)[C@H](NCCc1ccccc1)C(=O)NC(=O)[C@@H](C[C@H](O)[C@H](CC1CCCCC1)NC(=O)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C35H59N3O4/c1-8-25(4)32(36-20-19-26-15-11-9-12-16-26)34(42)38-33(41)28(24(2)3)22-30(39)29(21-27-17-13-10-14-18-27)37-31(40)23-35(5,6)7/h9,11-12,15-16,24-25,27-30,32,36,39H,8,10,13-14,17-23H2,1-7H3,(H,37,40)(H,38,41,42)/t25-,28-,29-,30-,32-/m0/s1 |
| InChIKey | UQSXAXVAJPUWLF-HNXJGGLFSA-N |
| XLogP | 5.79 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |