C14H12N2O4 — CID 703724
3-(3,4-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-oxadiazole (PubChem CID 703724) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 703724 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(-c3ccco3)n2)cc1OC |
| InChI | InChI=1S/C14H12N2O4/c1-17-10-6-5-9(8-12(10)18-2)13-15-14(20-16-13)11-4-3-7-19-11/h3-8H,1-2H3 |
| InChIKey | CYPIQGIKLKUTEX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |