C23H36O5 — CID 70377539
methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(6-hydroxy-6-bicyclo[3.2.0]heptanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 70377539) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(6-hydroxy-6-bicyclo[3.2.0]heptanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(6-hydroxy-6-bicyclo[3.2.0]heptanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70377539 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(6-hydroxy-6-bicyclo[3.2.0]heptanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/CC1(O)CC2CCCC21 |
| InChI | InChI=1S/C23H36O5/c1-28-22(26)12-5-3-2-4-9-17-18(21(25)14-20(17)24)10-7-13-23(27)15-16-8-6-11-19(16)23/h7,10,16-19,21,25,27H,2-6,8-9,11-15H2,1H3/b10-7+/t16?,17-,18-,19?,21-,23?/m1/s1 |
| InChIKey | HZRUWAKIQCPAAI-WQJIMNEJSA-N |
| XLogP | 3.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|