C24H38O5 — CID 70377546
methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(7-hydroxy-7-bicyclo[4.2.0]octanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 70377546) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(7-hydroxy-7-bicyclo[4.2.0]octanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(7-hydroxy-7-bicyclo[4.2.0]octanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70377546 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-3-(7-hydroxy-7-bicyclo[4.2.0]octanyl)prop-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/CC1(O)CC2CCCCC21 |
| InChI | InChI=1S/C24H38O5/c1-29-23(27)13-5-3-2-4-10-18-19(22(26)15-21(18)25)11-8-14-24(28)16-17-9-6-7-12-20(17)24/h8,11,17-20,22,26,28H,2-7,9-10,12-16H2,1H3/b11-8+/t17?,18-,19-,20?,22-,24?/m1/s1 |
| InChIKey | NMEJCCSUCPOHEF-UQPRJBNZSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|