C8H18N8O2 — CID 70379725
N-[[amino-(morpholin-4-ylamino)methylidene]amino]-N-(diaminomethylideneamino)acetamide (PubChem CID 70379725) has the molecular formula C8H18N8O2 and a molecular weight of 258.29 g/mol. Its IUPAC name is N-[[amino-(morpholin-4-ylamino)methylidene]amino]-N-(diaminomethylideneamino)acetamide.
| Compound Name | N-[[amino-(morpholin-4-ylamino)methylidene]amino]-N-(diaminomethylideneamino)acetamide |
|---|---|
| PubChem CID | 70379725 |
| Molecular Formula | C8H18N8O2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N-[[amino-(morpholin-4-ylamino)methylidene]amino]-N-(diaminomethylideneamino)acetamide |
| SMILES | CC(=O)N(N=C(N)N)N=C(N)NN1CCOCC1 |
| InChI | InChI=1S/C8H18N8O2/c1-6(17)16(12-7(9)10)14-8(11)13-15-2-4-18-5-3-15/h2-5H2,1H3,(H4,9,10,12)(H3,11,13,14) |
| InChIKey | BICYYKCIVDQGFS-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|