C7H11N — CID 70384253
2,3,7,8-tetrahydro-1H-pyrrolizine (PubChem CID 70384253) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 2,3,7,8-tetrahydro-1H-pyrrolizine.
| Compound Name | 2,3,7,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 70384253 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2,3,7,8-tetrahydro-1H-pyrrolizine |
| SMILES | C1=CN2CCCC2C1 |
| InChI | InChI=1S/C7H11N/c1-3-7-4-2-6-8(7)5-1/h1,5,7H,2-4,6H2 |
| InChIKey | SKFUDSXMJPHUCO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |