C19H20N2O3 — CID 70385420
(10-oxo-8-azatricyclo[5.3.1.03,8]undecan-2-yl) 1H-indole-2-carboxylate (PubChem CID 70385420) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (10-oxo-8-azatricyclo[5.3.1.03,8]undecan-2-yl) 1H-indole-2-carboxylate.
| Compound Name | (10-oxo-8-azatricyclo[5.3.1.03,8]undecan-2-yl) 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 70385420 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (10-oxo-8-azatricyclo[5.3.1.03,8]undecan-2-yl) 1H-indole-2-carboxylate |
| SMILES | O=C(OC1C2CC3CCCC1N3CC2=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20N2O3/c22-17-10-21-12-5-3-7-16(21)18(13(17)9-12)24-19(23)15-8-11-4-1-2-6-14(11)20-15/h1-2,4,6,8,12-13,16,18,20H,3,5,7,9-10H2 |
| InChIKey | FUFMDKZALNXXIK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |