C24H32O4 — CID 70386017
[(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] acetate (PubChem CID 70386017) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] acetate |
|---|---|
| PubChem CID | 70386017 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@H]1CC(=O)[C@@]2(C)CC[C@H]3[C@@H](CCC4=CC(=O)C=C(C)[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C24H32O4/c1-13-10-17(26)11-16-6-7-18-20(24(13,16)5)8-9-23(4)21(27)12-19(22(18)23)14(2)28-15(3)25/h10-11,14,18-20,22H,6-9,12H2,1-5H3/t14-,18+,19-,20-,22+,23+,24-/m0/s1 |
| InChIKey | GXYJAGUFGZJWKW-GEDIHUBRSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |