C25H34O4 — CID 10111490
1-[(15S)-1,10-dimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-15-yl]butan-2-yl acetate (PubChem CID 10111490) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 1-[(15S)-1,10-dimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-15-yl]butan-2-yl acetate.
| Compound Name | 1-[(15S)-1,10-dimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-15-yl]butan-2-yl acetate |
|---|---|
| PubChem CID | 10111490 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[(15S)-1,10-dimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-15-yl]butan-2-yl acetate |
| SMILES | CCC(CC1CC(=O)C2CCC3C(CCC4=CC(=O)C=C(C)C43C)C12)OC(C)=O |
| InChI | InChI=1S/C25H34O4/c1-5-19(29-15(3)26)11-16-12-23(28)21-8-9-22-20(24(16)21)7-6-17-13-18(27)10-14(2)25(17,22)4/h10,13,16,19-22,24H,5-9,11-12H2,1-4H3 |
| InChIKey | VPQBAAHNMSWEHM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |