C26H36O4 — CID 70386172
[(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] butanoate (PubChem CID 70386172) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] butanoate.
| Compound Name | [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] butanoate |
|---|---|
| PubChem CID | 70386172 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [(1S)-1-[(8R,9S,10S,13S,14R,15R)-1,10,13-trimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]ethyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C)[C@@H]1CC(=O)[C@@]2(C)CC[C@H]3[C@@H](CCC4=CC(=O)C=C(C)[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C26H36O4/c1-6-7-23(29)30-16(3)20-14-22(28)25(4)11-10-21-19(24(20)25)9-8-17-13-18(27)12-15(2)26(17,21)5/h12-13,16,19-21,24H,6-11,14H2,1-5H3/t16-,19+,20-,21-,24+,25+,26-/m0/s1 |
| InChIKey | NPKDCTZMYNPVQT-SGPVUHQCSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |