C36H31Cl4NO9 — CID 70387289
4-amino-2,3-bis[(3,4-dichloro-6,9-dioxo-8a-propyl-7,8-dihydrofluoren-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 70387289) has the molecular formula C36H31Cl4NO9 and a molecular weight of 763.45 g/mol. Its IUPAC name is 4-amino-2,3-bis[(3,4-dichloro-6,9-dioxo-8a-propyl-7,8-dihydrofluoren-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 4-amino-2,3-bis[(3,4-dichloro-6,9-dioxo-8a-propyl-7,8-dihydrofluoren-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70387289 |
| Molecular Formula | C36H31Cl4NO9 |
| Molecular Weight | 763.45 g/mol |
| Exact Mass | 761.08 |
| IUPAC Name | 4-amino-2,3-bis[(3,4-dichloro-6,9-dioxo-8a-propyl-7,8-dihydrofluoren-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CCCC12CCC(=O)C=C1c1c(cc(OC(C(N)=O)C(Oc3cc4c(c(Cl)c3Cl)C3=CC(=O)CCC3(CCC)C4=O)C(=O)O)c(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C36H31Cl4NO9/c1-3-7-35-9-5-15(42)11-19(35)23-17(31(35)44)13-21(25(37)27(23)39)49-29(33(41)46)30(34(47)48)50-22-14-18-24(28(40)26(22)38)20-12-16(43)6-10-36(20,8-4-2)32(18)45/h11-14,29-30H,3-10H2,1-2H3,(H2,41,46)(H,47,48) |
| InChIKey | QDECIZQNNVWBQW-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.45 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |