C19H23Cl3N2O2 — CID 70438284
2-[[(8aR)-3,4-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl]oxy]-N'-methylethanimidamide;hydrochloride (PubChem CID 70438284) has the molecular formula C19H23Cl3N2O2 and a molecular weight of 417.76 g/mol. Its IUPAC name is 2-[[(8aR)-3,4-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl]oxy]-N'-methylethanimidamide;hydrochloride.
| Compound Name | 2-[[(8aR)-3,4-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl]oxy]-N'-methylethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 70438284 |
| Molecular Formula | C19H23Cl3N2O2 |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[[(8aR)-3,4-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl]oxy]-N'-methylethanimidamide;hydrochloride |
| SMILES | CCC[C@]12CCC(=O)C=C1c1c(cc(OC/C(N)=N/C)c(Cl)c1Cl)C2.Cl |
| InChI | InChI=1S/C19H22Cl2N2O2.ClH/c1-3-5-19-6-4-12(24)8-13(19)16-11(9-19)7-14(17(20)18(16)21)25-10-15(22)23-2;/h7-8H,3-6,9-10H2,1-2H3,(H2,22,23);1H/t19-;/m1./s1 |
| InChIKey | WVDKHXNDJQFCKR-FSRHSHDFSA-N |
| XLogP | 4.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|