C19H22Cl2N2O2 — CID 21289571
2-[(3,4-dichloro-6-oxo-8a-propyl-7,8,9,10-tetrahydrophenanthren-2-yl)oxy]ethanimidamide (PubChem CID 21289571) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 2-[(3,4-dichloro-6-oxo-8a-propyl-7,8,9,10-tetrahydrophenanthren-2-yl)oxy]ethanimidamide.
| Compound Name | 2-[(3,4-dichloro-6-oxo-8a-propyl-7,8,9,10-tetrahydrophenanthren-2-yl)oxy]ethanimidamide |
|---|---|
| PubChem CID | 21289571 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[(3,4-dichloro-6-oxo-8a-propyl-7,8,9,10-tetrahydrophenanthren-2-yl)oxy]ethanimidamide |
| SMILES | [H]/N=C(\N)COc1cc2c(c(Cl)c1Cl)C1=CC(=O)CCC1(CCC)CC2 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-2-5-19-6-3-11-8-14(25-10-15(22)23)17(20)18(21)16(11)13(19)9-12(24)4-7-19/h8-9H,2-7,10H2,1H3,(H3,22,23) |
| InChIKey | NTUHTVIFQHVDEB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|