C25H32Cl2N2O2 — CID 54155242
5,6-dichloro-9a-hexan-3-yl-7-(2-imino-2-pyrrolidin-1-ylethoxy)-2,9-dihydro-1H-fluoren-3-one (PubChem CID 54155242) has the molecular formula C25H32Cl2N2O2 and a molecular weight of 463.45 g/mol. Its IUPAC name is 5,6-dichloro-9a-hexan-3-yl-7-(2-imino-2-pyrrolidin-1-ylethoxy)-2,9-dihydro-1H-fluoren-3-one.
| Compound Name | 5,6-dichloro-9a-hexan-3-yl-7-(2-imino-2-pyrrolidin-1-ylethoxy)-2,9-dihydro-1H-fluoren-3-one |
|---|---|
| PubChem CID | 54155242 |
| Molecular Formula | C25H32Cl2N2O2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 5,6-dichloro-9a-hexan-3-yl-7-(2-imino-2-pyrrolidin-1-ylethoxy)-2,9-dihydro-1H-fluoren-3-one |
| SMILES | [H]/N=C(/COc1cc2c(c(Cl)c1Cl)C1=CC(=O)CCC1(C(CC)CCC)C2)N1CCCC1 |
| InChI | InChI=1S/C25H32Cl2N2O2/c1-3-7-17(4-2)25-9-8-18(30)13-19(25)22-16(14-25)12-20(23(26)24(22)27)31-15-21(28)29-10-5-6-11-29/h12-13,17,28H,3-11,14-15H2,1-2H3/b28-21- |
| InChIKey | OKOYWFOBLVBGOC-HFTWOUSFSA-N |
| XLogP | 6.56 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|