C17H19Cl2NO5 — CID 88839805
2-[[(1Z)-6,7-dichloro-2-(1-hydroxycyclopentyl)-1-hydroxyimino-2-methyl-3H-inden-5-yl]oxy]acetic acid (PubChem CID 88839805) has the molecular formula C17H19Cl2NO5 and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-[[(1Z)-6,7-dichloro-2-(1-hydroxycyclopentyl)-1-hydroxyimino-2-methyl-3H-inden-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1Z)-6,7-dichloro-2-(1-hydroxycyclopentyl)-1-hydroxyimino-2-methyl-3H-inden-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 88839805 |
| Molecular Formula | C17H19Cl2NO5 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-[[(1Z)-6,7-dichloro-2-(1-hydroxycyclopentyl)-1-hydroxyimino-2-methyl-3H-inden-5-yl]oxy]acetic acid |
| SMILES | CC1(C2(O)CCCC2)Cc2cc(OCC(=O)O)c(Cl)c(Cl)c2/C1=N\O |
| InChI | InChI=1S/C17H19Cl2NO5/c1-16(17(23)4-2-3-5-17)7-9-6-10(25-8-11(21)22)13(18)14(19)12(9)15(16)20-24/h6,23-24H,2-5,7-8H2,1H3,(H,21,22)/b20-15+ |
| InChIKey | WMYMBPLTIXJMTO-HMMYKYKNSA-N |
| XLogP | 3.50 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|