C20H19Cl2NO4 — CID 88839555
2-(6,7-dichloro-1-hydroxyimino-2,2,3-trimethyl-3-phenylinden-5-yl)oxyacetic acid (PubChem CID 88839555) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is 2-(6,7-dichloro-1-hydroxyimino-2,2,3-trimethyl-3-phenylinden-5-yl)oxyacetic acid.
| Compound Name | 2-(6,7-dichloro-1-hydroxyimino-2,2,3-trimethyl-3-phenylinden-5-yl)oxyacetic acid |
|---|---|
| PubChem CID | 88839555 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-(6,7-dichloro-1-hydroxyimino-2,2,3-trimethyl-3-phenylinden-5-yl)oxyacetic acid |
| SMILES | CC1(C)C(=NO)c2c(cc(OCC(=O)O)c(Cl)c2Cl)C1(C)c1ccccc1 |
| InChI | InChI=1S/C20H19Cl2NO4/c1-19(2)18(23-26)15-12(20(19,3)11-7-5-4-6-8-11)9-13(16(21)17(15)22)27-10-14(24)25/h4-9,26H,10H2,1-3H3,(H,24,25) |
| InChIKey | RAJRQBUPFUHULI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|