C15H15Cl2NO4 — CID 88839181
2-[6,7-dichloro-1-[(Z)-hydroxyiminomethyl]-2'-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]-5-yl]oxyacetic acid (PubChem CID 88839181) has the molecular formula C15H15Cl2NO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is 2-[6,7-dichloro-1-[(Z)-hydroxyiminomethyl]-2'-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]-5-yl]oxyacetic acid.
| Compound Name | 2-[6,7-dichloro-1-[(Z)-hydroxyiminomethyl]-2'-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 88839181 |
| Molecular Formula | C15H15Cl2NO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[6,7-dichloro-1-[(Z)-hydroxyiminomethyl]-2'-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]-5-yl]oxyacetic acid |
| SMILES | CC1CC12Cc1cc(OCC(=O)O)c(Cl)c(Cl)c1C2/C=N\O |
| InChI | InChI=1S/C15H15Cl2NO4/c1-7-3-15(7)4-8-2-10(22-6-11(19)20)13(16)14(17)12(8)9(15)5-18-21/h2,5,7,9,21H,3-4,6H2,1H3,(H,19,20)/b18-5- |
| InChIKey | QPTXSLNSNJLSNR-DVZOWYKESA-N |
| XLogP | 3.58 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|