C26H51N4O2+ — CID 70387510
dimethyl-[3-(methylaminomethyl)-1,5-bis(2-oxopyrrolidin-1-yl)pentan-3-yl]-nonylazanium (PubChem CID 70387510) has the molecular formula C26H51N4O2+ and a molecular weight of 451.72 g/mol. Its IUPAC name is dimethyl-[3-(methylaminomethyl)-1,5-bis(2-oxopyrrolidin-1-yl)pentan-3-yl]-nonylazanium.
| Compound Name | dimethyl-[3-(methylaminomethyl)-1,5-bis(2-oxopyrrolidin-1-yl)pentan-3-yl]-nonylazanium |
|---|---|
| PubChem CID | 70387510 |
| Molecular Formula | C26H51N4O2+ |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 451.40 |
| IUPAC Name | dimethyl-[3-(methylaminomethyl)-1,5-bis(2-oxopyrrolidin-1-yl)pentan-3-yl]-nonylazanium |
| SMILES | CCCCCCCCC[N+](C)(C)C(CCN1CCCC1=O)(CCN1CCCC1=O)CNC |
| InChI | InChI=1S/C26H51N4O2/c1-5-6-7-8-9-10-11-22-30(3,4)26(23-27-2,16-20-28-18-12-14-24(28)31)17-21-29-19-13-15-25(29)32/h27H,5-23H2,1-4H3/q+1 |
| InChIKey | FWIOSDXXCGMQFN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|