dibutyl(phenyl)stannanylium chloride

C14H23ClSn — CID 70392444

IUPACdibutyl(phenyl)stannanylium chloride
SMILESCCCC[Sn+](CCCC)c1ccccc1.[Cl-]
InChIInChI=1S/C6H5.2C4H9.ClH.Sn/c1-2-4-6-5-3-1;2*1-3-4-2;;/h1-5H;2*1,3-4H2,2H3;1H;/q;;;;+1/p-1
InChIKeyBYEXJZDWUBTOMU-UHFFFAOYSA-M
MW345.50 g/mol
LogP0.99
Rot. Bonds7

About dibutyl(phenyl)stannanylium chloride

dibutyl(phenyl)stannanylium chloride (PubChem CID 70392444) has the molecular formula C14H23ClSn and a molecular weight of 345.50 g/mol. Its IUPAC name is dibutyl(phenyl)stannanylium chloride.

Molecular Properties

Compound Namedibutyl(phenyl)stannanylium chloride
PubChem CID70392444
Molecular FormulaC14H23ClSn
Molecular Weight345.50 g/mol
Exact Mass346.05
IUPAC Namedibutyl(phenyl)stannanylium chloride
SMILESCCCC[Sn+](CCCC)c1ccccc1.[Cl-]
InChIInChI=1S/C6H5.2C4H9.ClH.Sn/c1-2-4-6-5-3-1;2*1-3-4-2;;/h1-5H;2*1,3-4H2,2H3;1H;/q;;;;+1/p-1
InChIKeyBYEXJZDWUBTOMU-UHFFFAOYSA-M
XLogP0.99
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.50
LogP ≤ 50.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze dibutyl(phenyl)stannanylium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibutyl(phenyl)stannanylium chloride?
The IUPAC name of dibutyl(phenyl)stannanylium chloride (CID 70392444) is dibutyl(phenyl)stannanylium chloride.
What is the SMILES notation for dibutyl(phenyl)stannanylium chloride?
The canonical SMILES for dibutyl(phenyl)stannanylium chloride is CCCC[Sn+](CCCC)c1ccccc1.[Cl-].
What is the InChIKey of dibutyl(phenyl)stannanylium chloride?
The InChIKey is BYEXJZDWUBTOMU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.2C4H9.ClH.Sn/c1-2-4-6-5-3-1;2*1-3-4-2;;/h1-5H;2*1,3-4H2,2H3;1H;/q;;;;+1/p-1.
What are the key properties of dibutyl(phenyl)stannanylium chloride?
dibutyl(phenyl)stannanylium chloride has a molecular weight of 345.50 g/mol, XLogP of 0.99, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(phenyl)stannanylium chloride is sourced from PubChem (CID 70392444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).