C20H32O3 — CID 70393863
(2E,7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one (PubChem CID 70393863) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2E,7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one.
| Compound Name | (2E,7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
|---|---|
| PubChem CID | 70393863 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2E,7E,11E)-7,11-dimethyl-13-(oxan-2-yloxy)trideca-2,7,11-trien-4-one |
| SMILES | C/C=C/C(=O)CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C20H32O3/c1-4-8-19(21)13-12-17(2)9-7-10-18(3)14-16-23-20-11-5-6-15-22-20/h4,8-9,14,20H,5-7,10-13,15-16H2,1-3H3/b8-4+,17-9+,18-14+ |
| InChIKey | VMGUIEPBGHCREL-AHRKTIPBSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|