C17H20N2O4 — CID 70396945
ethyl 4-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]benzoate (PubChem CID 70396945) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 4-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]benzoate.
| Compound Name | ethyl 4-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 70396945 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethyl 4-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NC(C)c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-4-22-16(20)13-6-8-14(9-7-13)19-17(21)18-12(3)15-10-5-11(2)23-15/h5-10,12H,4H2,1-3H3,(H2,18,19,21) |
| InChIKey | GUBAKAFWTPVTDA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |