C29H49NO3 — CID 70396949
[(4aS,7S,8S,8aS)-4,4,7,8a-tetramethyl-8-[(3S)-3-methylpent-4-enoyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl] 3-piperidin-1-ylbutanoate (PubChem CID 70396949) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is [(4aS,7S,8S,8aS)-4,4,7,8a-tetramethyl-8-[(3S)-3-methylpent-4-enoyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl] 3-piperidin-1-ylbutanoate.
| Compound Name | [(4aS,7S,8S,8aS)-4,4,7,8a-tetramethyl-8-[(3S)-3-methylpent-4-enoyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl] 3-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 70396949 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | [(4aS,7S,8S,8aS)-4,4,7,8a-tetramethyl-8-[(3S)-3-methylpent-4-enoyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl] 3-piperidin-1-ylbutanoate |
| SMILES | C=C[C@@H](C)CC(=O)[C@H]1[C@@H](C)CC[C@H]2C(C)(C)CCC(OC(=O)CC(C)N3CCCCC3)[C@]12C |
| InChI | InChI=1S/C29H49NO3/c1-8-20(2)18-23(31)27-21(3)12-13-24-28(5,6)15-14-25(29(24,27)7)33-26(32)19-22(4)30-16-10-9-11-17-30/h8,20-22,24-25,27H,1,9-19H2,2-7H3/t20-,21+,22?,24+,25?,27-,29-/m1/s1 |
| InChIKey | HZIKXYTYVDQWOP-QDCGCMKZSA-N |
| XLogP | 6.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|