C19H24N2O4S — CID 70399319
tert-butyl N-[1-hydroxy-3-phenyl-1-(thiophene-3-carbonylamino)propan-2-yl]carbamate (PubChem CID 70399319) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-3-phenyl-1-(thiophene-3-carbonylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-3-phenyl-1-(thiophene-3-carbonylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 70399319 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | tert-butyl N-[1-hydroxy-3-phenyl-1-(thiophene-3-carbonylamino)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)NC(=O)c1ccsc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-19(2,3)25-18(24)20-15(11-13-7-5-4-6-8-13)17(23)21-16(22)14-9-10-26-12-14/h4-10,12,15,17,23H,11H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | DCJJCBVZQBISDN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|