C18H18F3NO2 — CID 70400447
3-butyl-2-[3-(trifluoromethyl)anilino]benzoic acid (PubChem CID 70400447) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-butyl-2-[3-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 3-butyl-2-[3-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 70400447 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-butyl-2-[3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | CCCCc1cccc(C(=O)O)c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO2/c1-2-3-6-12-7-4-10-15(17(23)24)16(12)22-14-9-5-8-13(11-14)18(19,20)21/h4-5,7-11,22H,2-3,6H2,1H3,(H,23,24) |
| InChIKey | APLVOIHSQPSVMU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |