About cyclopenta[c][2,1]benzoxazine
cyclopenta[c][2,1]benzoxazine (PubChem CID 70400701) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is cyclopenta[c][2,1]benzoxazine.
Molecular Properties
| Compound Name | cyclopenta[c][2,1]benzoxazine |
| PubChem CID | 70400701 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | cyclopenta[c][2,1]benzoxazine |
| SMILES | c1cc2onc3ccccc3c-2c1 |
| InChI | InChI=1S/C11H7NO/c1-2-6-10-8(4-1)9-5-3-7-11(9)13-12-10/h1-7H |
| InChIKey | LRHPSBGKBOYRGY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[c][2,1]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[c][2,1]benzoxazine?
The IUPAC name of cyclopenta[c][2,1]benzoxazine (CID 70400701) is cyclopenta[c][2,1]benzoxazine.
What is the SMILES notation for cyclopenta[c][2,1]benzoxazine?
The canonical SMILES for cyclopenta[c][2,1]benzoxazine is c1cc2onc3ccccc3c-2c1.
What is the InChIKey of cyclopenta[c][2,1]benzoxazine?
The InChIKey is LRHPSBGKBOYRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c1-2-6-10-8(4-1)9-5-3-7-11(9)13-12-10/h1-7H.
What are the key properties of cyclopenta[c][2,1]benzoxazine?
cyclopenta[c][2,1]benzoxazine has a molecular weight of 169.18 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[c][2,1]benzoxazine is sourced from PubChem (CID 70400701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).