About 3-pyridazin-3-yl-2,1-benzoxazole
3-pyridazin-3-yl-2,1-benzoxazole (PubChem CID 10888861) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 3-pyridazin-3-yl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 3-pyridazin-3-yl-2,1-benzoxazole |
| PubChem CID | 10888861 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-pyridazin-3-yl-2,1-benzoxazole |
| SMILES | c1cnnc(-c2onc3ccccc23)c1 |
| InChI | InChI=1S/C11H7N3O/c1-2-5-9-8(4-1)11(15-14-9)10-6-3-7-12-13-10/h1-7H |
| InChIKey | JKGHSNPMXUXMIV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridazin-3-yl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridazin-3-yl-2,1-benzoxazole?
The IUPAC name of 3-pyridazin-3-yl-2,1-benzoxazole (CID 10888861) is 3-pyridazin-3-yl-2,1-benzoxazole.
What is the SMILES notation for 3-pyridazin-3-yl-2,1-benzoxazole?
The canonical SMILES for 3-pyridazin-3-yl-2,1-benzoxazole is c1cnnc(-c2onc3ccccc23)c1.
What is the InChIKey of 3-pyridazin-3-yl-2,1-benzoxazole?
The InChIKey is JKGHSNPMXUXMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c1-2-5-9-8(4-1)11(15-14-9)10-6-3-7-12-13-10/h1-7H.
What are the key properties of 3-pyridazin-3-yl-2,1-benzoxazole?
3-pyridazin-3-yl-2,1-benzoxazole has a molecular weight of 197.20 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridazin-3-yl-2,1-benzoxazole is sourced from PubChem (CID 10888861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).