C27H33ClO9 — CID 70400867
4-O-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,6-dioxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] 1-O-methyl butanedioate (PubChem CID 70400867) has the molecular formula C27H33ClO9 and a molecular weight of 537.01 g/mol. Its IUPAC name is 4-O-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,6-dioxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,6-dioxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 70400867 |
| Molecular Formula | C27H33ClO9 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 4-O-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,6-dioxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)O[C@]1(C(=O)CO)C(C)C[C@H]2[C@@H]3CC(=O)C4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H33ClO9/c1-14-9-16-17-11-19(31)18-10-15(30)7-8-24(18,2)26(17,28)20(32)12-25(16,3)27(14,21(33)13-29)37-23(35)6-5-22(34)36-4/h7-8,10,14,16-17,20,29,32H,5-6,9,11-13H2,1-4H3/t14?,16-,17-,20?,24-,25-,26-,27-/m0/s1 |
| InChIKey | QSHPODYTYQXBRC-OOLYEBIKSA-N |
| XLogP | 1.85 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|