C10H9Cl2NO3S — CID 704035
(2R,4R)-2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 704035) has the molecular formula C10H9Cl2NO3S and a molecular weight of 294.16 g/mol. Its IUPAC name is (2R,4R)-2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 704035 |
| Molecular Formula | C10H9Cl2NO3S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | (2R,4R)-2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@H](c2cc(Cl)cc(Cl)c2O)N1 |
| InChI | InChI=1S/C10H9Cl2NO3S/c11-4-1-5(8(14)6(12)2-4)9-13-7(3-17-9)10(15)16/h1-2,7,9,13-14H,3H2,(H,15,16)/t7-,9+/m0/s1 |
| InChIKey | ARUVJGDFRGFHKM-IONNQARKSA-N |
| XLogP | 2.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|