C13H17NO3 — CID 70404368
(4aS,11bS)-9-methoxy-3,4,4a,5,6,11b-hexahydro-2H-[1]benzoxepino[5,4-b][1,4]oxazine (PubChem CID 70404368) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (4aS,11bS)-9-methoxy-3,4,4a,5,6,11b-hexahydro-2H-[1]benzoxepino[5,4-b][1,4]oxazine.
| Compound Name | (4aS,11bS)-9-methoxy-3,4,4a,5,6,11b-hexahydro-2H-[1]benzoxepino[5,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 70404368 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (4aS,11bS)-9-methoxy-3,4,4a,5,6,11b-hexahydro-2H-[1]benzoxepino[5,4-b][1,4]oxazine |
| SMILES | COc1ccc2c(c1)OCC[C@@H]1NCCO[C@@H]21 |
| InChI | InChI=1S/C13H17NO3/c1-15-9-2-3-10-12(8-9)16-6-4-11-13(10)17-7-5-14-11/h2-3,8,11,13-14H,4-7H2,1H3/t11-,13-/m0/s1 |
| InChIKey | ILSRDQSTEYWAKS-AAEUAGOBSA-N |
| XLogP | 1.51 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |