C13H15NO4 — CID 54290602
(2R,7R)-3,10,14,16-tetraoxa-6-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17)-triene (PubChem CID 54290602) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2R,7R)-3,10,14,16-tetraoxa-6-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17)-triene.
| Compound Name | (2R,7R)-3,10,14,16-tetraoxa-6-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17)-triene |
|---|---|
| PubChem CID | 54290602 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2R,7R)-3,10,14,16-tetraoxa-6-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17)-triene |
| SMILES | c1c2c(cc3c1OCC[C@H]1NCCO[C@H]31)OCO2 |
| InChI | InChI=1S/C13H15NO4/c1-3-15-10-6-12-11(17-7-18-12)5-8(10)13-9(1)14-2-4-16-13/h5-6,9,13-14H,1-4,7H2/t9-,13-/m1/s1 |
| InChIKey | RXFQFDBJXKUENN-NOZJJQNGSA-N |
| XLogP | 1.23 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |