C11H13NO2 — CID 84663247
2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazin-8-ol (PubChem CID 84663247) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazin-8-ol.
| Compound Name | 2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazin-8-ol |
|---|---|
| PubChem CID | 84663247 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazin-8-ol |
| SMILES | Oc1ccc2c(c1)C1OCCNC1C2 |
| InChI | InChI=1S/C11H13NO2/c13-8-2-1-7-5-10-11(9(7)6-8)14-4-3-12-10/h1-2,6,10-13H,3-5H2 |
| InChIKey | XSHRDGIGZANZAX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |