C11H12O8 — CID 70406487
bicyclo[2.2.1]heptane-2,2,5,6-tetracarboxylic acid (PubChem CID 70406487) has the molecular formula C11H12O8 and a molecular weight of 272.21 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2,2,5,6-tetracarboxylic acid.
| Compound Name | bicyclo[2.2.1]heptane-2,2,5,6-tetracarboxylic acid |
|---|---|
| PubChem CID | 70406487 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | bicyclo[2.2.1]heptane-2,2,5,6-tetracarboxylic acid |
| SMILES | O=C(O)C1C2CC(C1C(=O)O)C(C(=O)O)(C(=O)O)C2 |
| InChI | InChI=1S/C11H12O8/c12-7(13)5-3-1-4(6(5)8(14)15)11(2-3,9(16)17)10(18)19/h3-6H,1-2H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | OBHAVQGHCSXLPF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|