C27H42O5 — CID 70407738
(3aR,4R,5R,6aS)-4-[4-methyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 70407738) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[4-methyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[4-methyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 70407738 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[4-methyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CCCC(C)CC=C(OC1CCCCO1)[C@@H]1[C@@H]2CC(=O)C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H42O5/c1-3-4-9-19(2)12-13-23(31-25-10-5-7-14-29-25)27-22-18-21(28)16-20(22)17-24(27)32-26-11-6-8-15-30-26/h3,13,19-20,22,24-27H,1,4-12,14-18H2,2H3/t19?,20-,22-,24-,25?,26?,27+/m1/s1 |
| InChIKey | FMWCRBBPTUIEEK-REDBWXJISA-N |
| XLogP | 5.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|