C10H20N4O2 — CID 70408576
(E)-but-2-enediamide;1,2-dimethylpiperazine (PubChem CID 70408576) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is (E)-but-2-enediamide;1,2-dimethylpiperazine.
| Compound Name | (E)-but-2-enediamide;1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 70408576 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (E)-but-2-enediamide;1,2-dimethylpiperazine |
| SMILES | CC1CNCCN1C.NC(=O)/C=C/C(N)=O |
| InChI | InChI=1S/C6H14N2.C4H6N2O2/c1-6-5-7-3-4-8(6)2;5-3(7)1-2-4(6)8/h6-7H,3-5H2,1-2H3;1-2H,(H2,5,7)(H2,6,8)/b;2-1+ |
| InChIKey | YSNMDQYJVKFSFN-WLHGVMLRSA-N |
| XLogP | -1.58 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|