C24H14F5N3O5 — CID 70408880
N,4-bis(2,2-difluoro-1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408880) has the molecular formula C24H14F5N3O5 and a molecular weight of 519.38 g/mol. Its IUPAC name is N,4-bis(2,2-difluoro-1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N,4-bis(2,2-difluoro-1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408880 |
| Molecular Formula | C24H14F5N3O5 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | N,4-bis(2,2-difluoro-1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)N1CC(c2ccc3c(c2)OC(F)(F)O3)=C(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C24H14F5N3O5/c25-14-4-1-12(2-5-14)21-16(13-3-7-17-19(9-13)36-23(26,27)34-17)11-32(31-21)22(33)30-15-6-8-18-20(10-15)37-24(28,29)35-18/h1-10,31H,11H2,(H,30,33) |
| InChIKey | HWZWRYJKXIESTD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|