C24H19Cl2N3O3 — CID 70409603
4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70409603) has the molecular formula C24H19Cl2N3O3 and a molecular weight of 468.34 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70409603 |
| Molecular Formula | C24H19Cl2N3O3 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)N1CC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C24H19Cl2N3O3/c25-17-5-1-15(2-6-17)20-14-29(28-23(20)16-3-7-18(26)8-4-16)24(30)27-19-9-10-21-22(13-19)32-12-11-31-21/h1-10,13,28H,11-12,14H2,(H,27,30) |
| InChIKey | UIVDOYACBJODGT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|