C25H21Cl2N3O — CID 70408761
4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408761) has the molecular formula C25H21Cl2N3O and a molecular weight of 450.37 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408761 |
| Molecular Formula | C25H21Cl2N3O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)N1CC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C25H21Cl2N3O/c26-20-9-4-17(5-10-20)23-15-30(29-24(23)18-6-11-21(27)12-7-18)25(31)28-22-13-8-16-2-1-3-19(16)14-22/h4-14,29H,1-3,15H2,(H,28,31) |
| InChIKey | ZGQZEJRUCFNLAD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|