C32H30ClN3O2 — CID 70408088
N-[4-(4-tert-butylphenoxy)phenyl]-5-(4-chlorophenyl)-4-phenyl-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408088) has the molecular formula C32H30ClN3O2 and a molecular weight of 524.06 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenoxy)phenyl]-5-(4-chlorophenyl)-4-phenyl-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N-[4-(4-tert-butylphenoxy)phenyl]-5-(4-chlorophenyl)-4-phenyl-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408088 |
| Molecular Formula | C32H30ClN3O2 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[4-(4-tert-butylphenoxy)phenyl]-5-(4-chlorophenyl)-4-phenyl-1,3-dihydropyrazole-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(NC(=O)N3CC(c4ccccc4)=C(c4ccc(Cl)cc4)N3)cc2)cc1 |
| InChI | InChI=1S/C32H30ClN3O2/c1-32(2,3)24-11-17-27(18-12-24)38-28-19-15-26(16-20-28)34-31(37)36-21-29(22-7-5-4-6-8-22)30(35-36)23-9-13-25(33)14-10-23/h4-20,35H,21H2,1-3H3,(H,34,37) |
| InChIKey | KZGWJCPKXIEIQM-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|