C28H20ClF2N3O2 — CID 70409617
N-[4-(4-chlorophenoxy)phenyl]-4,5-bis(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70409617) has the molecular formula C28H20ClF2N3O2 and a molecular weight of 503.94 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)phenyl]-4,5-bis(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N-[4-(4-chlorophenoxy)phenyl]-4,5-bis(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70409617 |
| Molecular Formula | C28H20ClF2N3O2 |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | N-[4-(4-chlorophenoxy)phenyl]-4,5-bis(4-fluorophenyl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)cc1)N1CC(c2ccc(F)cc2)=C(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C28H20ClF2N3O2/c29-20-5-13-24(14-6-20)36-25-15-11-23(12-16-25)32-28(35)34-17-26(18-1-7-21(30)8-2-18)27(33-34)19-3-9-22(31)10-4-19/h1-16,33H,17H2,(H,32,35) |
| InChIKey | AUCLZTFCLRTNAK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|