C28H21F2N3OS — CID 88642585
4,5-bis(4-fluorophenyl)-N-(4-phenoxyphenyl)-1,3-dihydropyrazole-2-carbothioamide (PubChem CID 88642585) has the molecular formula C28H21F2N3OS and a molecular weight of 485.56 g/mol. Its IUPAC name is 4,5-bis(4-fluorophenyl)-N-(4-phenoxyphenyl)-1,3-dihydropyrazole-2-carbothioamide.
| Compound Name | 4,5-bis(4-fluorophenyl)-N-(4-phenoxyphenyl)-1,3-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 88642585 |
| Molecular Formula | C28H21F2N3OS |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4,5-bis(4-fluorophenyl)-N-(4-phenoxyphenyl)-1,3-dihydropyrazole-2-carbothioamide |
| SMILES | Fc1ccc(C2=C(c3ccc(F)cc3)NN(C(=S)Nc3ccc(Oc4ccccc4)cc3)C2)cc1 |
| InChI | InChI=1S/C28H21F2N3OS/c29-21-10-6-19(7-11-21)26-18-33(32-27(26)20-8-12-22(30)13-9-20)28(35)31-23-14-16-25(17-15-23)34-24-4-2-1-3-5-24/h1-17,32H,18H2,(H,31,35) |
| InChIKey | BLPCCYYTVVCRKR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|