C29H23Cl2N3O3 — CID 70408104
N-[4-(4-chlorophenoxy)phenyl]-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408104) has the molecular formula C29H23Cl2N3O3 and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)phenyl]-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N-[4-(4-chlorophenoxy)phenyl]-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408104 |
| Molecular Formula | C29H23Cl2N3O3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[4-(4-chlorophenoxy)phenyl]-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | COc1ccc(C2=C(c3ccc(Cl)cc3)NN(C(=O)Nc3ccc(Oc4ccc(Cl)cc4)cc3)C2)cc1 |
| InChI | InChI=1S/C29H23Cl2N3O3/c1-36-24-12-4-19(5-13-24)27-18-34(33-28(27)20-2-6-21(30)7-3-20)29(35)32-23-10-16-26(17-11-23)37-25-14-8-22(31)9-15-25/h2-17,33H,18H2,1H3,(H,32,35) |
| InChIKey | HGUTXJRTAAXXGT-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|