C28H20Cl3N3O2 — CID 70408814
N-[4-(3-chlorophenoxy)phenyl]-4,5-bis(4-chlorophenyl)-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408814) has the molecular formula C28H20Cl3N3O2 and a molecular weight of 536.85 g/mol. Its IUPAC name is N-[4-(3-chlorophenoxy)phenyl]-4,5-bis(4-chlorophenyl)-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N-[4-(3-chlorophenoxy)phenyl]-4,5-bis(4-chlorophenyl)-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408814 |
| Molecular Formula | C28H20Cl3N3O2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-[4-(3-chlorophenoxy)phenyl]-4,5-bis(4-chlorophenyl)-1,3-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2cccc(Cl)c2)cc1)N1CC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C28H20Cl3N3O2/c29-20-8-4-18(5-9-20)26-17-34(33-27(26)19-6-10-21(30)11-7-19)28(35)32-23-12-14-24(15-13-23)36-25-3-1-2-22(31)16-25/h1-16,33H,17H2,(H,32,35) |
| InChIKey | SZLWIDNRFWBNAP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|