C28H22ClN3OS — CID 88642615
4-(4-chlorophenyl)-N-(4-phenoxyphenyl)-5-phenyl-1,3-dihydropyrazole-2-carbothioamide (PubChem CID 88642615) has the molecular formula C28H22ClN3OS and a molecular weight of 484.02 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(4-phenoxyphenyl)-5-phenyl-1,3-dihydropyrazole-2-carbothioamide.
| Compound Name | 4-(4-chlorophenyl)-N-(4-phenoxyphenyl)-5-phenyl-1,3-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 88642615 |
| Molecular Formula | C28H22ClN3OS |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(4-phenoxyphenyl)-5-phenyl-1,3-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(Nc1ccc(Oc2ccccc2)cc1)N1CC(c2ccc(Cl)cc2)=C(c2ccccc2)N1 |
| InChI | InChI=1S/C28H22ClN3OS/c29-22-13-11-20(12-14-22)26-19-32(31-27(26)21-7-3-1-4-8-21)28(34)30-23-15-17-25(18-16-23)33-24-9-5-2-6-10-24/h1-18,31H,19H2,(H,30,34) |
| InChIKey | CBELYIPTEZEXTI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|