C9H16O5 — CID 70409483
(3R,4S,5R)-2-methoxy-5-(prop-2-enoxymethyl)oxolane-3,4-diol (PubChem CID 70409483) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (3R,4S,5R)-2-methoxy-5-(prop-2-enoxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-methoxy-5-(prop-2-enoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70409483 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (3R,4S,5R)-2-methoxy-5-(prop-2-enoxymethyl)oxolane-3,4-diol |
| SMILES | C=CCOC[C@H]1OC(OC)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O5/c1-3-4-13-5-6-7(10)8(11)9(12-2)14-6/h3,6-11H,1,4-5H2,2H3/t6-,7-,8-,9?/m1/s1 |
| InChIKey | FAXSEWGIGLUBIS-BYBOBHAWSA-N |
| XLogP | -0.72 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|