C33H45ClN2O — CID 70414376
2-[4-[4-(2-chloro-3,7-dimethyloctoxy)phenyl]phenyl]-5-heptylpyrimidine (PubChem CID 70414376) has the molecular formula C33H45ClN2O and a molecular weight of 521.19 g/mol. Its IUPAC name is 2-[4-[4-(2-chloro-3,7-dimethyloctoxy)phenyl]phenyl]-5-heptylpyrimidine.
| Compound Name | 2-[4-[4-(2-chloro-3,7-dimethyloctoxy)phenyl]phenyl]-5-heptylpyrimidine |
|---|---|
| PubChem CID | 70414376 |
| Molecular Formula | C33H45ClN2O |
| Molecular Weight | 521.19 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 2-[4-[4-(2-chloro-3,7-dimethyloctoxy)phenyl]phenyl]-5-heptylpyrimidine |
| SMILES | CCCCCCCc1cnc(-c2ccc(-c3ccc(OCC(Cl)C(C)CCCC(C)C)cc3)cc2)nc1 |
| InChI | InChI=1S/C33H45ClN2O/c1-5-6-7-8-9-13-27-22-35-33(36-23-27)30-16-14-28(15-17-30)29-18-20-31(21-19-29)37-24-32(34)26(4)12-10-11-25(2)3/h14-23,25-26,32H,5-13,24H2,1-4H3 |
| InChIKey | MORSIGMYRVSVOH-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.19 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|