C42H40N8O8 — CID 70415798
bis[6-carbamoyl-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate (PubChem CID 70415798) has the molecular formula C42H40N8O8 and a molecular weight of 784.83 g/mol. Its IUPAC name is bis[6-carbamoyl-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate.
| Compound Name | bis[6-carbamoyl-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 70415798 |
| Molecular Formula | C42H40N8O8 |
| Molecular Weight | 784.83 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | bis[6-carbamoyl-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate |
| SMILES | Cc1nccn1CC1CC(OC(=O)/C=C\C(=O)OC2CC(Cn3ccnc3C)C(=O)c3c2n(C)c2ccc(C(N)=O)cc32)c2c(c3cc(C(N)=O)ccc3n2C)C1=O |
| InChI | InChI=1S/C42H40N8O8/c1-21-45-11-13-49(21)19-25-17-31(37-35(39(25)53)27-15-23(41(43)55)5-7-29(27)47(37)3)57-33(51)9-10-34(52)58-32-18-26(20-50-14-12-46-22(50)2)40(54)36-28-16-24(42(44)56)6-8-30(28)48(4)38(32)36/h5-16,25-26,31-32H,17-20H2,1-4H3,(H2,43,55)(H2,44,56)/b10-9- |
| InChIKey | DGTFFFVBDYJDMN-KTKRTIGZSA-N |
| XLogP | 4.11 |
| TPSA | 218.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|