C18H30N2O3 — CID 70415964
[(2S)-1-[benzyl(propan-2-yl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamic acid (PubChem CID 70415964) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(2S)-1-[benzyl(propan-2-yl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamic acid.
| Compound Name | [(2S)-1-[benzyl(propan-2-yl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 70415964 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | [(2S)-1-[benzyl(propan-2-yl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamic acid |
| SMILES | CC(C)CC(NC(=O)O)[C@@H](O)CN(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H30N2O3/c1-13(2)10-16(19-18(22)23)17(21)12-20(14(3)4)11-15-8-6-5-7-9-15/h5-9,13-14,16-17,19,21H,10-12H2,1-4H3,(H,22,23)/t16?,17-/m0/s1 |
| InChIKey | BBHYDLRTBHSCGQ-DJNXLDHESA-N |
| XLogP | 2.94 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |